465-61-2 Usage
Uses
Used in Organic Synthesis:
(1S,3S)-2,2-dichlorocyclopentane-1,3-diol is utilized as a reactant in organic synthesis, particularly for the production of chiral compounds. Its unique structure and stereochemistry make it a valuable intermediate for creating various complex organic molecules.
Used in Pharmaceutical Synthesis:
(1S,3S)-2,2-dichlorocyclopentane-1,3-diol serves as a building block in the synthesis of pharmaceuticals, contributing to the development of new drugs. Its specific stereochemistry ensures that the resulting pharmaceuticals have the desired biological activity and selectivity.
Used in Agrochemical Synthesis:
(1S,3S)-2,2-dichlorocyclopentane-1,3-diol is also used in the synthesis of agrochemicals, playing a role in the development of pesticides and other agricultural products. Its properties allow for the creation of effective and targeted agrochemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 465-61-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,6 and 5 respectively; the second part has 2 digits, 6 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 465-61:
(5*4)+(4*6)+(3*5)+(2*6)+(1*1)=72
72 % 10 = 2
So 465-61-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H8Cl2O2/c6-5(7)3(8)1-2-4(5)9/h3-4,8-9H,1-2H2/t3-,4-/m0/s1
