480438-57-1 Usage
Uses
Used in Organic Synthesis:
3-Chloro-4-propoxyphenylboronic acid serves as a valuable building block in organic synthesis, particularly for the creation of pharmaceuticals, agrochemicals, and other biologically active molecules. Its structural components allow for a variety of chemical reactions, facilitating the development of complex organic compounds.
Used in Suzuki-Miyaura Cross-Coupling Reactions:
In the realm of organic chemistry, 3-Chloro-4-propoxyphenylboronic acid is utilized as a reagent in Suzuki-Miyaura cross-coupling reactions. This reaction is a powerful method for the formation of carbon-carbon bonds, which is crucial for assembling the molecular frameworks of many organic compounds, including those with potential pharmaceutical applications.
Used in Analytical Applications:
3-Chloro-4-propoxyphenylboronic acid is known for its capacity to form stable complexes with diols and other Lewis basic functional groups. This property renders it advantageous in the development of sensors and other analytical tools, where selective detection and binding of specific molecules are required.
Used in the Development of Sensors:
Leveraging its ability to form stable complexes, 3-Chloro-4-propoxyphenylboronic acid is used in the development of sensors designed to detect and measure the presence of certain compounds. Its selectivity and stability make it a promising candidate for sensor technology in various fields, including environmental monitoring, medical diagnostics, and industrial process control.
Check Digit Verification of cas no
The CAS Registry Mumber 480438-57-1 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 4,8,0,4,3 and 8 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 480438-57:
(8*4)+(7*8)+(6*0)+(5*4)+(4*3)+(3*8)+(2*5)+(1*7)=161
161 % 10 = 1
So 480438-57-1 is a valid CAS Registry Number.
InChI:InChI=1/C9H12BClO3/c1-2-5-14-9-4-3-7(10(12)13)6-8(9)11/h3-4,6,12-13H,2,5H2,1H3
