486-73-7 Usage
Description
Isoquinoline-1-carboxylic acid is an organic compound belonging to the isoquinoline family, characterized by a fused pyridine and pyrrole ring structure. It is a cream to yellow-brown powder in appearance and is known for its chemical properties that make it a versatile compound in various applications.
Uses
Used in Pharmaceutical Industry:
Isoquinoline-1-carboxylic acid is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows it to be a key component in the development of drugs targeting specific receptors or enzymes in the body.
Used in Chemical Synthesis:
Isoquinoline-1-carboxylic acid serves as a building block in the preparation of other organic compounds, such as 4-cyano-3-ethoxy-1-hydroxy-5,6,7,8-tetrahydroisoquinoline. This application highlights its utility in the chemical synthesis of complex molecules for various purposes, including potential therapeutic uses.
Used in Research and Development:
Due to its unique chemical properties and structural features, Isoquinoline-1-carboxylic acid is also used in research and development for the exploration of new chemical reactions, synthesis methods, and potential applications in various fields, including material science and medicinal chemistry.
Check Digit Verification of cas no
The CAS Registry Mumber 486-73-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 4,8 and 6 respectively; the second part has 2 digits, 7 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 486-73:
(5*4)+(4*8)+(3*6)+(2*7)+(1*3)=87
87 % 10 = 7
So 486-73-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H7NO2/c12-10(13)9-8-4-2-1-3-7(8)5-6-11-9/h1-6H,(H,12,13)/p-1
486-73-7Relevant articles and documents
Nature of Reissert Analogs Derived from N,N-Dialkyl and N,N-Diaryl Carbamoyl Chlorides
Kant, Joydeep,Popp, Frank D.,Uff, Barrie C.
, p. 1065 - 1070 (2007/10/02)
Reissert analogs were prepared from the reaction of isoquinoline and phthalazine with carbamoyl chlorides and cyanide using the methylene chloride-water method.Alkylation, condensation, Michael addition, and hydrolysis reactions of these Reissert analogs have been studied and found in many cases, to be similar to those of the isoquinoline Reissert compound.