500889-65-6 Usage
Uses
Used in Pharmaceutical Industry:
1,2,4-Benzotriazin-3-amine, 7-bromois used as a key intermediate in the synthesis of various pharmaceuticals. Its unique structure and properties allow for the development of new compounds with specific therapeutic effects, contributing to the advancement of drug discovery and innovation.
Used in Agrochemical Industry:
In the agrochemical industry, 1,2,4-Benzotriazin-3-amine, 7-bromoserves as a crucial building block for the synthesis of agrochemicals with targeted biological activities. Its application in this field aids in the development of effective and environmentally friendly solutions for pest control and crop protection.
Used in Research and Development:
1,2,4-Benzotriazin-3-amine, 7-bromois utilized in research and development for the exploration of its unique properties and potential applications. Its versatility as a chemical compound allows scientists to investigate its use in various fields, including the development of new materials, catalysts, and other specialty chemicals.
Overall, 1,2,4-Benzotriazin-3-amine, 7-bromois a valuable chemical compound with diverse applications across different industries, particularly in the development of pharmaceuticals and agrochemicals, as well as in research and development efforts. Its unique properties and potential as a building block for new compounds make it an essential component in the ongoing pursuit of scientific advancements and innovations.
Check Digit Verification of cas no
The CAS Registry Mumber 500889-65-6 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,0,8,8 and 9 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 500889-65:
(8*5)+(7*0)+(6*0)+(5*8)+(4*8)+(3*9)+(2*6)+(1*5)=156
156 % 10 = 6
So 500889-65-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H5BrN4/c8-4-1-2-5-6(3-4)11-12-7(9)10-5/h1-3H,(H2,9,10,12)
500889-65-6Relevant academic research and scientific papers
Organic compound and organic electroluminescent device containing same
-
, (2021/05/05)
The invention relates to an organic compound, which is characterized by having a structure as shown in (1), wherein L1 and L2 are respectively and independently selected from a single bond, a substituted or unsubstituted C6-C30 arylene group or a substituted or unsubstituted C3-C30 heteroarylene group; Arl and Ar2 are respectively and independently selected from a substituted or unsubstituted C6-C30 aryl group or a substituted or unsubstituted C3-C30 heteroaryl group; R is halogen, a cyano group, an alkyl group, a substituted or unsubstituted C6-C30 aryl group or a substituted or unsubstituted C3-C30 heteroaryl group; and n represents an integer of 0-3.
