5018-31-5 Usage
Uses
Used in Pharmaceutical and Agrochemical Synthesis:
2-Methoxymalonamide is utilized as a key building block for the synthesis of various pharmaceuticals and agrochemicals. Its chemical properties make it a valuable component in the development of new drugs and agricultural chemicals, contributing to advancements in healthcare and agriculture.
Used in Coordination Chemistry:
In the field of coordination chemistry, 2-Methoxymalonamide serves as a ligand, participating in the formation of coordination compounds. Its ability to bind with metal ions enhances the stability and reactivity of these compounds, broadening their applications in various chemical processes.
Used as a Stabilizer for Peroxide Compounds:
2-Methoxymalonamide is employed as a stabilizer for peroxide compounds, enhancing their stability and safety in various industrial applications. Its stabilizing effect is crucial in preventing the premature decomposition of peroxides, which can be hazardous.
Used in Medical Applications:
Although still under investigation, 2-Methoxymalonamide has shown potential in the medical field for the treatment of certain diseases and disorders. Its specific applications and effects are being studied to fully understand its potential contributions to healthcare.
Check Digit Verification of cas no
The CAS Registry Mumber 5018-31-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,0,1 and 8 respectively; the second part has 2 digits, 3 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5018-31:
(6*5)+(5*0)+(4*1)+(3*8)+(2*3)+(1*1)=65
65 % 10 = 5
So 5018-31-5 is a valid CAS Registry Number.
InChI:InChI=1/C4H8N2O3/c1-9-2(3(5)7)4(6)8/h2H,1H3,(H2,5,7)(H2,6,8)
