502639-08-9 Usage
Uses
Used in Pharmaceutical Industry:
4-Piperidinamine,1-(2-methoxyethyl)-(9CI) is used as a building block for the synthesis of various pharmaceuticals and organic compounds. Its unique structure allows it to be a versatile component in the development of new drugs and medications.
Used in Drug Production:
4-Piperidinamine,1-(2-methoxyethyl)-(9CI) is used as a precursor in the production of certain drugs. Its presence in the molecular structure of these drugs contributes to their therapeutic properties and effectiveness.
Used in Organic Synthesis:
4-Piperidinamine,1-(2-methoxyethyl)-(9CI) is used as a reagent in chemical reactions, facilitating the synthesis of a wide range of organic compounds. Its ability to participate in various chemical processes makes it a valuable asset in the field of organic chemistry.
Used in Medicinal Chemistry and Drug Development:
4-Piperidinamine,1-(2-methoxyethyl)-(9CI) may have potential applications in the field of medicinal chemistry and drug development. Its unique properties and structure make it a promising candidate for further research and development in creating new and improved pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 502639-08-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,0,2,6,3 and 9 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 502639-08:
(8*5)+(7*0)+(6*2)+(5*6)+(4*3)+(3*9)+(2*0)+(1*8)=129
129 % 10 = 9
So 502639-08-9 is a valid CAS Registry Number.
InChI:InChI=1/C8H18N2O/c1-11-7-6-10-4-2-8(9)3-5-10/h8H,2-7,9H2,1H3
502639-08-9Relevant academic research and scientific papers
OPIOID AGONISTS AND USES THEREOF
-
Paragraph 00311, (2015/06/11)
Provided are compounds, including those of Formula I; and pharmaceutically acceptable salts and solvates thereof. The compounds described herein relate to and/or have application(s) in (among others) the fields of drug discovery, pharmacotherapy, physiology, organic chemistry and polymer chemistry.
