50361-60-9 Usage
Explanation
The molecular formula represents the number of atoms of each element present in a molecule. In this case, the compound has 11 carbon (C) atoms, 15 hydrogen (H) atoms, 1 nitrogen (N) atom, and 1 oxygen (O) atom.
Explanation
The compound is derived from a tetrahydro-naphthalen-1-ol, which is a type of naphthalene with four hydrogen atoms added to its structure. The aminomethyl group (-CH2NH2) is attached to the 1-position, which is the first carbon atom in the naphthalene ring.
Explanation
The compound contains an amino group, which is a nitrogen atom bonded to two hydrogen atoms. It also has a hydroxyl group, which is an oxygen atom bonded to a hydrogen atom. Additionally, the compound features alkyl groups, which are chains of carbon and hydrogen atoms.
Explanation
Due to its unique structure and functional groups, 1-AMINOMETHYL-1,2,3,4-TETRAHYDRO-NAPHTHALEN-1-OL is used as a precursor or intermediate in the synthesis of various pharmaceuticals and organic compounds. Its versatility makes it a valuable building block for drug discovery and development.
Explanation
The compound's unique structure and reactivity make it a promising candidate for use in the field of organic synthesis and chemical research. Researchers can explore its potential applications in creating new compounds and materials with specific properties.
Explanation
The presence of amino, hydroxyl, and alkyl groups in the compound allows it to participate in a range of chemical reactions, such as substitution, addition, and condensation reactions. This reactivity is essential for its use in pharmaceutical synthesis and organic chemistry.
Structure
Tetrahydro-naphthalen-1-ol derivative with an aminomethyl group at the 1-position
Functional Groups
Amino (-NH2), hydroxyl (-OH), and alkyl (-CH2-) groups
Applications
Pharmaceutical synthesis, organic compounds, drug discovery, and development
Potential Uses
Organic synthesis and chemical research
Reactivity
Can undergo various chemical reactions due to its functional groups
Check Digit Verification of cas no
The CAS Registry Mumber 50361-60-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,3,6 and 1 respectively; the second part has 2 digits, 6 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 50361-60:
(7*5)+(6*0)+(5*3)+(4*6)+(3*1)+(2*6)+(1*0)=89
89 % 10 = 9
So 50361-60-9 is a valid CAS Registry Number.
InChI:InChI=1/C11H15NO/c12-8-11(13)7-3-5-9-4-1-2-6-10(9)11/h1-2,4,6,13H,3,5,7-8,12H2
50361-60-9Relevant articles and documents
FUSED IMIDAZOLE DERIVATIVE
-
Page 6, (2008/06/13)
According to the present invention, fused imidazole derivatives of the general formula: wherein R1 is a hydrogen atom, a halogen atom, hydroxy group, a lower alkyl group or a lower alkoxy group, R2 is an aryl group, benzodioxanyl group, or 5-6 membered, monocyclic, unsaturated, heterocyclic group containing nitrogen atom(s) which may be substituted with lower alkyl, trityl or oxo, R3 is a hydrogen atom or hydroxy group, A is a group represented by the formula : -(CH2)m - or -O-(CH2)m- [wherein m is an integer of 1-3] and their salts are provided.
N6-Substituted Adenosine Receptor Agonists: Potential AntihypertensiveAgents
Trivedi, B. K.,Blankley, C. J.,Bristol, J. A.,Hamilton, H. W.,Patt, W. C.,et al.
, p. 1043 - 1049 (2007/10/02)
Adenosine is known to exert a wide range of pharmacological effects including hypotension.This effect of adenosine suggested that modified analogues of adenosine might provide useful antihypertensive agents.Thus, we prepared a series of novel N6/sup