50477-28-6 Usage
Uses
Used in Organic Synthesis:
5,7-Dibromo-1H-indazole is used as a chemical intermediate for the synthesis of various organic compounds. Its unique structure and Bromine substituents make it a valuable building block in the creation of new molecules with potential applications in various industries.
Used in Pharmaceutical Research:
5,7-Dibromo-1H-indazole is employed as a research tool in the development of new pharmaceuticals. Its properties and reactivity can be explored to design and synthesize novel drug candidates, potentially leading to the discovery of new therapeutic agents.
Used in Research Applications:
5,7-Dibromo-1H-indazole is used as a research compound in various scientific studies. Its unique chemical properties and potential interactions with other molecules make it an interesting subject for investigation in fields such as chemistry, biology, and materials science. 5,7-Dibromo-1H-indazole can provide insights into the behavior of similar compounds and contribute to the advancement of scientific knowledge.
Check Digit Verification of cas no
The CAS Registry Mumber 50477-28-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,4,7 and 7 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 50477-28:
(7*5)+(6*0)+(5*4)+(4*7)+(3*7)+(2*2)+(1*8)=116
116 % 10 = 6
So 50477-28-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H4Br2N2/c8-5-1-4-3-10-11-7(4)6(9)2-5/h1-3H,(H,10,11)
50477-28-6Relevant academic research and scientific papers
Efficient and scalable synthesis of 3,5,7-trisubstituted 1H-indazoles as potent IKK2 inhibitors
Lin, Xichen,Busch-Petersen, Jakob,Deng, Jianghe,Edwards, Christine,Zhang, Zhaoguo,Kerns, Jeffrey K.
scheme or table, p. 3216 - 3220 (2009/06/18)
Efficient and scalable chemical approaches to 3,5,7-trisubstituted 1H-indazoles were developed and applied to the synthesis of 1,1-dimethylethyl 4-[7-(aminocarbonyl)-5-bromo-1H-indazol-3-yl]-1-piperidinecarboxylate, a key intermediate for 3,5,7-trisubstit
