50543-23-2 Usage
Uses
Used in Pharmaceutical Industry:
2-Fluoro-6-hydroxypyridine is utilized as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic chemistry, 2-Fluoro-6-hydroxypyridine serves as a valuable building block for the creation of more complex molecules. Its presence in these molecules can influence their reactivity, stability, and overall properties, making it a useful component in the synthesis of a wide range of organic compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 50543-23-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,5,4 and 3 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 50543-23:
(7*5)+(6*0)+(5*5)+(4*4)+(3*3)+(2*2)+(1*3)=92
92 % 10 = 2
So 50543-23-2 is a valid CAS Registry Number.
InChI:InChI=1/C5H4FNO/c6-4-2-1-3-5(8)7-4/h1-3H,(H,7,8)
50543-23-2Relevant academic research and scientific papers
6-Fluoropyridyl-(di)(thio)phosphoric acid esters
-
, (2008/06/13)
6-Fluoropyridyl-(di)(thio)phosphoric acid esters, and their use for combating pests, especially from the classes of insects and Nemathelminthes. The 6-fluoropyridyl-(di)(thio)phosphoric acid esters have the formula STR1 where X is oxygen or sulfur, R1 is linear or branched alkyl of a maximum of 3 carbon atoms and R2 is linear or branched alkylthio of a maximum of 6 carbon atoms.
