506-25-2 Usage
Uses
Used in Pharmaceutical Industry:
Isanic acid is used as an active pharmaceutical ingredient for its unique chemical properties. Its ability to readily polymerize and its reactivity with air and heat make it a valuable compound in the development of new drugs and therapies.
Used in Chemical Synthesis:
Isanic acid is utilized as a key intermediate in the synthesis of various organic compounds. Its acetylenic triple bonds at the 9 and 11 positions provide a versatile platform for further chemical reactions, enabling the creation of a wide range of molecules with diverse applications.
Used in Polymer Industry:
Due to its propensity to polymerize, isanic acid is employed in the polymer industry as a monomer for the production of polymers with specific properties. These polymers can be tailored for use in various applications, such as coatings, adhesives, and plastics, where their unique characteristics can be advantageous.
Used in Research and Development:
Isanic acid serves as an important research tool in the field of organic chemistry. Its unique chemical properties and reactivity make it an interesting subject for studying various chemical reactions and mechanisms, contributing to the advancement of scientific knowledge and the development of new technologies.
Check Digit Verification of cas no
The CAS Registry Mumber 506-25-2 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,0 and 6 respectively; the second part has 2 digits, 2 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 506-25:
(5*5)+(4*0)+(3*6)+(2*2)+(1*5)=52
52 % 10 = 2
So 506-25-2 is a valid CAS Registry Number.
InChI:InChI=1/C18H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2H,1,3-6,11-17H2,(H,19,20)