50648-93-6 Usage
Description
MESO-1,2-BIS(4-FLUOROPHENYL)ETHYLENEDIAMINE, also known as (1R,2S)-1,2-Bis(4-fluorophenyl)ethane-1,2-diamine, is an off-white crystalline powder with unique chemical properties. It is a reagent that plays a significant role in the fluorometric determination of reducing sugars in body fluids, making it a valuable compound in the field of analytical chemistry and biochemistry.
Uses
Used in Analytical Chemistry:
MESO-1,2-BIS(4-FLUOROPHENYL)ETHYLENEDIAMINE is used as a reagent for the fluorometric determination of reducing sugars in body fluids. Its application is crucial for accurately measuring and analyzing the levels of reducing sugars, which are essential for understanding various biological processes and diagnosing certain medical conditions.
Used in Pharmaceutical Research:
In the pharmaceutical industry, MESO-1,2-BIS(4-FLUOROPHENYL)ETHYLENEDIAMINE is used as a starting material or intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential applications in treating a wide range of diseases.
Used in Chemical Synthesis:
MESO-1,2-BIS(4-FLUOROPHENYL)ETHYLENEDIAMINE is also used as a building block in the synthesis of complex organic molecules. Its versatile chemical properties make it a valuable component in the creation of new compounds with potential applications in various industries, including materials science, agrochemicals, and specialty chemicals.
Check Digit Verification of cas no
The CAS Registry Mumber 50648-93-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,6,4 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 50648-93:
(7*5)+(6*0)+(5*6)+(4*4)+(3*8)+(2*9)+(1*3)=126
126 % 10 = 6
So 50648-93-6 is a valid CAS Registry Number.
InChI:InChI=1/C14H14F2N2/c15-11-5-1-9(2-6-11)13(17)14(18)10-3-7-12(16)8-4-10/h1-8,13-14H,17-18H2/p+2/t13-,14+
50648-93-6Relevant articles and documents
Tumor inhibiting platinum-(II) complexes. Part I: synthesis
Muller, Richard,Gust, Ronald,Jennerwein, Margaretha,Reile, Herta,Laske, Reiner,et al.
, p. 341 - 348 (2007/10/02)
The synthesis of the diastereomeric 1,2-bis(2-, 3-, and 4-fluorophenyl)ethylenediamines 4-6, 10-12 from meso-1,2-bis(2-hydroxyphenyl)ethylenediamine and 2-, 3-, and 4-fluorobenzaldehyde by a diaza-Cope-rearrangement and their conversion into the 1,2-bis(