50703-41-8 Usage
Uses
Used in Organic Synthesis:
(5Z)-Bicyclo[8.2.2]tetradecane-1(12),5,10,13-tetrene is used as a key intermediate in organic synthesis for its unique structural properties. Its strained carbon atoms and double bonds can be exploited to create novel chemical reactions and form new compounds with potential applications in various fields.
Used in Chemical Research:
As a complex chemical compound, (5Z)-Bicyclo[8.2.2]tetradecane-1(12),5,10,13-tetrene is used in chemical research to study its reactivity, stability, and potential interactions with other molecules. Understanding these properties can lead to the development of new synthetic methods and the discovery of new compounds with specific applications.
Used in Material Science:
(5Z)-Bicyclo[8.2.2]tetradecane-1(12),5,10,13-tetrene is used as a potential component in the development of novel materials due to its unique structural features. Its incorporation into materials could lead to new properties, such as enhanced stability, reactivity, or specific interactions with other molecules, which could be beneficial in various industrial applications.
Used in Pharmaceutical Development:
The unique structure and potential reactivity of (5Z)-Bicyclo[8.2.2]tetradecane-1(12),5,10,13-tetrene make it a candidate for pharmaceutical development. It could be used as a starting point for the design of new drugs or as a component in drug delivery systems, taking advantage of its specific interactions with biological targets.
Used in the Chemical Industry:
In the chemical industry, (5Z)-Bicyclo[8.2.2]tetradecane-1(12),5,10,13-tetrene could be used as a building block for the synthesis of more complex molecules with specific applications, such as specialty chemicals, additives, or coatings. Its unique properties may provide advantages in terms of performance, stability, or reactivity compared to other, more common compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 50703-41-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,0,7,0 and 3 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 50703-41:
(7*5)+(6*0)+(5*7)+(4*0)+(3*3)+(2*4)+(1*1)=88
88 % 10 = 8
So 50703-41-8 is a valid CAS Registry Number.
InChI:InChI=1/C14H18/c1-2-4-6-8-14-11-9-13(10-12-14)7-5-3-1/h1-2,9-12H,3-8H2/b2-1-
