513-80-4 Usage
General Description
Urea nitrate is a chemical compound that is formed by the combination of urea and nitric acid. It is commonly used in the production of explosive materials due to its high nitrogen content and explosive properties. Urea nitrate is white, crystalline, and highly soluble in water, making it suitable for use in various explosive formulations. However, it is also highly sensitive to heat, shock, and friction, which makes it prone to accidental detonation. Because of its high explosives potential, urea nitrate is regulated and strictly controlled by government authorities to prevent its illegal use in explosive devices.
Check Digit Verification of cas no
The CAS Registry Mumber 513-80-4 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 5,1 and 3 respectively; the second part has 2 digits, 8 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 513-80:
(5*5)+(4*1)+(3*3)+(2*8)+(1*0)=54
54 % 10 = 4
So 513-80-4 is a valid CAS Registry Number.
InChI:InChI=1/C2H2O4.CH4N2O/c3-1(4)2(5)6;2-1(3)4/h(H,3,4)(H,5,6);(H4,2,3,4)
