51363-01-0 Usage
Uses
Used in Pharmaceutical Synthesis:
4-(PYRID-2-YLOXY)BENZOYL CHLORIDE is used as a key intermediate for the synthesis of pharmaceuticals, contributing to the development of new drugs due to its unique structural features that can be incorporated into medicinal compounds.
Used in Agrochemical Production:
In the agrochemical industry, 4-(PYRID-2-YLOXY)BENZOYL CHLORIDE is utilized as a reagent in the synthesis of various agrochemicals, playing a role in the creation of substances that protect crops and enhance agricultural productivity.
Used in Polymer Production:
4-(PYRID-2-YLOXY)BENZOYL CHLORIDE is used as a building block in the production of polymers, where its chemical properties can influence the characteristics of the resulting polymers, such as their stability and reactivity.
Used in Dye Manufacturing:
4-(PYRID-2-YLOXY)BENZOYL CHLORIDE is also used in the manufacturing of dyes, where its ability to form colored compounds makes it a valuable component in the production of a variety of dyes used in different industries.
Used in Organic Chemistry Research:
4-(PYRID-2-YLOXY)BENZOYL CHLORIDE is employed as a versatile reagent in organic chemistry research, where it can be used to explore new reactions and develop innovative synthetic pathways for complex organic molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 51363-01-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,1,3,6 and 3 respectively; the second part has 2 digits, 0 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 51363-01:
(7*5)+(6*1)+(5*3)+(4*6)+(3*3)+(2*0)+(1*1)=90
90 % 10 = 0
So 51363-01-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H8ClNO2/c13-12(15)9-4-6-10(7-5-9)16-11-3-1-2-8-14-11/h1-8H
51363-01-0Relevant academic research and scientific papers
Substituted acetic acid derivatives and production thereof
-
, (2008/06/13)
Substituted acetic acid derivatives represented by the formula: SPC1 Wherein X, X', X", Y, Y' and Y" each represents a hydrogen atom, an alkyl group of 1 to 8 carbon atoms, an alkoxy group of 1 to 8 carbon atoms, a hydroxy group, an acyl group, an acylamino group, an acyloxy group, an amino group, a cyano group, a nitro group, an alkoxycarbonyl group of 2 to 9 carbon atoms, an alkoxycarbonylalkyl group of 3 to 10 carbon atoms, an alkoxycarbonylamino group of 2 to 9 carbon atoms, a trifluoromethyl group, a halogen atom, a carboxy group, or a carbamoyl group, two of X, X' and X", or two of Y, Y' and Y" are optionally combined to form an alicyclic ring of 5 to 7 carbon atoms or a benzene ring, A represents an oxygen atom or a sulfur atom, R and R1 each represents a hydrogen atom or a lower alkyl group of 1 to 4 carbon atoms and Q represents the optional presence of an oxygen atom, or their alkali metal or alkali earth metal salts, being useful as anti-inflammatory, anti-rheumatic, analgesic or anti-pyretic agents, are prepared essentially by the Arndt-Eistert reaction.
