5162-99-2 Usage
Uses
Used in Pharmaceutical and Agrochemical Production:
Diphenylthiirene 1,1-dioxide is utilized as a reactive intermediate in the synthesis of pharmaceuticals and agrochemicals, contributing to the development of new drugs and pesticides due to its unique chemical properties.
Used in Dye and Pigment Synthesis:
In the chemical industry, DPDO serves as a key component in the production of dyes and pigments, enhancing the color spectrum and performance of these products.
Used in Photodynamic Therapy for Cancer Treatment:
Diphenylthiirene 1,1-dioxide is recognized for its potential as a photosensitizer, making it a valuable agent in photodynamic therapy. This application leverages its ability to absorb light and generate reactive oxygen species, which can selectively destroy cancer cells upon light activation.
Used in Research and Development:
Due to its unique chemical characteristics, DPDO is also employed in research and development settings to explore new chemical reactions and applications, further expanding its utility in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 5162-99-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,6 and 2 respectively; the second part has 2 digits, 9 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5162-99:
(6*5)+(5*1)+(4*6)+(3*2)+(2*9)+(1*9)=92
92 % 10 = 2
So 5162-99-2 is a valid CAS Registry Number.
InChI:InChI=1/C14H10O2S/c15-17(16)13(11-7-3-1-4-8-11)14(17)12-9-5-2-6-10-12/h1-10H
