5180-79-0 Usage
Uses
Used in Polymer Production:
3-Isocyanatobenzoyl chloride is used as a monomer in the production of polymers, particularly polyurethane. It contributes to the formation of polymer chains that possess desirable properties such as flexibility, durability, and resistance to various environmental factors.
Used in Pharmaceutical Synthesis:
In the pharmaceutical industry, 3-isocyanatobenzoyl chloride serves as a chemical intermediate. It is utilized in the synthesis of various drugs, playing a crucial role in the development of new medicinal compounds that address a wide array of health conditions.
Used in Agrochemical Production:
3-Isocyanatobenzoyl chloride is also employed as an intermediate in the production of agrochemicals. Its reactivity allows for the creation of compounds that can be used in the development of pesticides, herbicides, and other agricultural products to enhance crop protection and yield.
Used in Dye Manufacturing:
3-ISOCYANATOBENZOYL CHLORIDE is used as a key intermediate in the manufacturing of dyes. Its chemical properties enable the production of dyes with specific color characteristics and stability, which are essential for various applications in textiles, printing, and other industries.
Safety Precautions:
Given its toxic and corrosive nature, 3-isocyanatobenzoyl chloride poses a risk of irritation to the skin, eyes, and respiratory system. It is imperative that only trained professionals handle this chemical in a well-ventilated area, employing appropriate personal protective equipment to ensure safety.
Check Digit Verification of cas no
The CAS Registry Mumber 5180-79-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,1,8 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 5180-79:
(6*5)+(5*1)+(4*8)+(3*0)+(2*7)+(1*9)=90
90 % 10 = 0
So 5180-79-0 is a valid CAS Registry Number.
InChI:InChI=1/C8H4ClNO2/c9-8(12)6-2-1-3-7(4-6)10-5-11/h1-4H
