52235-55-9 Usage
Uses
Used in Pharmaceutical Synthesis:
[[3-(aminomethyl)phenyl]methyl]carbamic acid is used as a key intermediate in the synthesis of various pharmaceuticals for its unique structural features and potential biological activities. Its presence in the molecular structure of drugs can contribute to their therapeutic effects and pharmacological properties.
Used in Research Chemicals:
In the field of research, [[3-(aminomethyl)phenyl]methyl]carbamic acid is employed as a research chemical to explore its potential applications in medicinal chemistry. It aids scientists in understanding its interactions with biological systems and its role in drug discovery processes.
Used in Medicinal Chemistry:
[[3-(aminomethyl)phenyl]methyl]carbamic acid is utilized in medicinal chemistry as a compound with potential biological activities. Its unique structure allows it to be a candidate for the development of new drugs, targeting specific diseases and conditions.
Used in Drug Discovery:
[[3-(aminomethyl)phenyl]methyl]carbamic acid is also used in drug discovery as a potential lead molecule. Its properties are being studied to identify its therapeutic potential, which can lead to the development of novel drugs with improved efficacy and safety profiles.
Check Digit Verification of cas no
The CAS Registry Mumber 52235-55-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,2,3 and 5 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 52235-55:
(7*5)+(6*2)+(5*2)+(4*3)+(3*5)+(2*5)+(1*5)=99
99 % 10 = 9
So 52235-55-9 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O2/c10-5-7-2-1-3-8(4-7)6-11-9(12)13/h1-4,11H,5-6,10H2,(H,12,13)
52235-55-9Relevant academic research and scientific papers
CO2-Selective Absorbents in Air: Reverse Lipid Bilayer Structure Forming Neutral Carbamic Acid in Water without Hydration
Inagaki, Fuyuhiko,Matsumoto, Chiaki,Iwata, Takashi,Mukai, Chisato
supporting information, p. 4639 - 4642 (2017/04/11)
Emission gas and air contain not only CO2 but also plentiful moisture, making it difficult to achieve selective CO2 absorption without hydration. To generate absorbed CO2 (wet CO2) under heating, the need for external energy to release the absorbed water has been among the most serious problems in the fields of carbon dioxide capture and storage (CCS) and direct air capture (DAC). We found that the introduction of the hydrophobic phenyl group into alkylamines of CO2 absorbents improved the absorption selectivity between CO2 and water. Furthermore, ortho-, meta-, and para-xylylenediamines (OXDA, MXDA, PXDA, respectively) absorbed only CO2 in air without any hydration. Notably, MXDA·CO2 was formed as an anhydrous carbamic acid even in water, presumably because it was covered with hydrophobic phenyl groups, which induces a reverse lipid bilayer structure. Dry CO2 was obtained from heating MXDA·CO2 at 103-120 °C, which was revealed to involve chemically the Grignard reaction to form the resulting carboxylic acids in high yields.
