52334-40-4 Usage
Uses
Used in Pharmaceutical Industry:
2-(Oxazolo[4,5-b]pyridine-2-yl)benzonitrile is used as a pharmaceutical intermediate for the synthesis of new drugs due to its unique molecular structure and functional groups, which can be further modified to create compounds with potential therapeutic effects.
Used in Materials Science:
2-(Oxazolo[4,5-b]pyridine-2-yl)benzonitrile is used as a building block in the development of new materials with specific properties, such as optical, electronic, or mechanical characteristics, owing to its versatile molecular structure and functional groups.
Used in Organic Synthesis:
2-(Oxazolo[4,5-b]pyridine-2-yl)benzonitrile is used as a key intermediate in organic synthesis for the preparation of various organic compounds, leveraging its reactive functional groups and unique structural features to facilitate the formation of desired products.
Further research and exploration of 2-(Oxazolo[4,5-b]pyridine-2-yl)benzonitrile's chemical reactivity and potential applications may provide valuable insights for the development of new and innovative compounds in the future, expanding its utility across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 52334-40-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,3,3 and 4 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 52334-40:
(7*5)+(6*2)+(5*3)+(4*3)+(3*4)+(2*4)+(1*0)=94
94 % 10 = 4
So 52334-40-4 is a valid CAS Registry Number.
InChI:InChI=1/C13H7N3O/c14-8-9-4-1-2-5-10(9)13-16-12-11(17-13)6-3-7-15-12/h1-7H
52334-40-4Relevant academic research and scientific papers
Anti-inflammatory oxazole[4,5-b]pyridines
-
, (2008/06/13)
The various isomers of oxazolo- and thiazolopyridines having utility as antiinflammatory, antipyretic and analgesic agents are prepared by condensation of an appropriate amino-hydroxypyridine or amino-mercaptopyridine with a carboxylic acid, halide or anhydride.