52494-33-4 Usage
Uses
Used in Pharmaceutical Industry:
5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is used as a pharmaceutical agent for its potential antifungal, antibacterial, and anticancer properties. Its unique structure allows it to target various biological pathways and mechanisms, making it a versatile compound for the development of new drugs and therapies.
Used in Antifungal Applications:
In the pharmaceutical industry, 5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is used as an antifungal agent to combat fungal infections. Its ability to inhibit fungal growth and disrupt essential cellular processes makes it a valuable compound for the development of antifungal drugs.
Used in Antibacterial Applications:
5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is also used as an antibacterial agent, targeting and inhibiting the growth of bacteria. Its potential to disrupt bacterial cell walls and essential metabolic processes makes it a promising candidate for the development of new antibiotics to combat antibiotic-resistant bacteria.
Used in Anticancer Applications:
In the field of oncology, 5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is used as an anticancer agent. Its potential to target and inhibit the growth of cancer cells, as well as its ability to modulate various oncological signaling pathways, makes it a valuable compound for the development of new cancer therapies.
Used in Agricultural Industry:
5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is used in the agricultural industry for its potential as a biopesticide. Its ability to inhibit the growth of harmful fungi and bacteria can help protect crops and improve overall crop health, making it a valuable tool for sustainable agriculture.
Used in Antioxidant and Metal-Chelating Applications:
Due to the presence of a thiol group in its structure, 5-(2-Methoxy-phenylamino)-[1,3,4]thiadiazole-2-thiol is used as an antioxidant and metal-chelating agent. Its ability to neutralize harmful reactive oxygen species and bind to metal ions can have potential applications in various industries, including pharmaceuticals, agriculture, and materials science.
Check Digit Verification of cas no
The CAS Registry Mumber 52494-33-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,4,9 and 4 respectively; the second part has 2 digits, 3 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 52494-33:
(7*5)+(6*2)+(5*4)+(4*9)+(3*4)+(2*3)+(1*3)=124
124 % 10 = 4
So 52494-33-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3OS2/c1-13-7-5-3-2-4-6(7)10-8-11-12-9(14)15-8/h2-5H,1H3,(H,10,11)(H,12,14)
52494-33-4Relevant academic research and scientific papers
Synthesis and antifungal activities of ω-(5-arylamino-1,3,4-thiadiazol-2-thio)-ω(1H-1,2,4-triazol-1-yl) acetophenones
Chu, Chang-Hu,Hui, Xin-Ping,Xu, Peng-Fei,Zhang, Zi-Yi,Li, Zhi-Chun,Liao, Ren-An
, p. 2436 - 2438 (2007/10/03)
Several ω-(5-arylamino-1,3,4-thiadiazol-2-thiol)-ω-(1H-1,2,4-triazol-1- yl)acetophenones 4a-i have been synthesized. The representative compounds exhibit some antifungal and plant growth regulatory activities. The structures of these compounds have been confirmed by elemental analyses, 1H NMR, IR and MS spectra.
