52548-62-6 Usage
General Description
2-amino-5-fluorobenzoic acid hydrochloride is a chemical compound that consists of a benzoic acid with a fluorine and an amino group attached to it, and a hydrochloride salt. It is commonly used in pharmaceuticals and organic synthesis as a building block for various drug compounds. The presence of the amino and fluorine groups in the molecule makes it useful for the development of drugs for a wide range of therapeutic applications. Additionally, the hydrochloride salt form improves the solubility of the compound, making it more suitable for use in formulations and drug delivery systems.
Check Digit Verification of cas no
The CAS Registry Mumber 52548-62-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,5,4 and 8 respectively; the second part has 2 digits, 6 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 52548-62:
(7*5)+(6*2)+(5*5)+(4*4)+(3*8)+(2*6)+(1*2)=126
126 % 10 = 6
So 52548-62-6 is a valid CAS Registry Number.
InChI:InChI=1/C7H6FNO2.ClH/c8-4-1-2-6(9)5(3-4)7(10)11;/h1-3H,9H2,(H,10,11);1H