525570-29-0 Usage
Description
4-[(2-CHLORO-4-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is a chemical compound with the molecular formula C15H11ClFO3. It is a benzaldehyde derivative that features a chloro-fluoro benzyl group and a methoxybenzaldehyde group. 4-[(2-CHLORO-4-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is known for its potential biological activities, such as anti-inflammatory and anti-cancer properties, and is also considered a promising building block in the development of new drug compounds.
Uses
Used in Pharmaceutical Industry:
4-[(2-CHLORO-4-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE is used as an intermediate in the synthesis of pharmaceuticals for its potential biological activities. It is particularly valued for its anti-inflammatory and anti-cancer properties, making it a key component in the development of new medications targeting these health issues.
Used in Agrochemical Industry:
In the agrochemical field, 4-[(2-CHLORO-4-FLUOROBENZYL)OXY]-3-METHOXYBENZALDEHYDE serves as an intermediate in the synthesis of agrochemicals. Its role is crucial in creating compounds that can help improve crop protection and yield by addressing various agricultural challenges.
Used in Drug Development:
4-[(2-chloro-4-fluorobenzyl)oxy]-3-methoxybenzaldehyde is utilized as a building block in the development of new drug compounds. Its unique structure and potential biological activities make it a valuable asset in the creation of innovative pharmaceuticals that can address a range of health concerns.
Check Digit Verification of cas no
The CAS Registry Mumber 525570-29-0 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,2,5,5,7 and 0 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 525570-29:
(8*5)+(7*2)+(6*5)+(5*5)+(4*7)+(3*0)+(2*2)+(1*9)=150
150 % 10 = 0
So 525570-29-0 is a valid CAS Registry Number.
InChI:InChI=1/C15H12ClFO3/c1-19-15-6-10(8-18)2-5-14(15)20-9-11-3-4-12(17)7-13(11)16/h2-8H,9H2,1H3
525570-29-0Relevant articles and documents
Use of estrogen related receptor-modulating aryl ethers
-
Page/Page column 20, (2008/06/13)
Therapeutic methods of using certain heterocyclic arylidene aryl ether compounds for treating diseases or disorders mediated through modulation of estrogen related receptor alpha are described.
