5267-07-2 Usage
Uses
Used in Pharmaceutical Industry:
5-Pyrimidineacetic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its application is primarily due to its ability to be incorporated into the structure of different drugs, enhancing their therapeutic effects.
Used in Ophthalmology:
5-Pyrimidineacetic acid is used as a starting material for the preparation of benzimidazolone muscarinic antagonists. These compounds have potential applications in the treatment and/or prevention of myopia (nearsightedness). The development of such drugs aims to address the growing prevalence of myopia and its associated visual impairments.
Used in Chemical Synthesis:
5-Pyrimidineacetic acid is also used in the preparation of fused imidazole derivatives. These derivatives find applications in various fields, including pharmaceuticals, agrochemicals, and materials science. The synthesis of these fused imidazoles is facilitated by the unique chemical properties of 5-Pyrimidineacetic acid, which allows for the formation of complex molecular structures with potential biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 5267-07-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,6 and 7 respectively; the second part has 2 digits, 0 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5267-07:
(6*5)+(5*2)+(4*6)+(3*7)+(2*0)+(1*7)=92
92 % 10 = 2
So 5267-07-2 is a valid CAS Registry Number.
InChI:InChI=1/C6H6N2O2/c9-6(10)1-5-2-7-4-8-3-5/h2-4H,1H2,(H,9,10)
