52868-64-1 Usage
Uses
Used in Pharmaceutical Research:
4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) is used as a key intermediate in the synthesis of various pharmaceutical compounds for its versatile chemical properties. Its unique structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) serves as a valuable building block for the creation of complex organic molecules. Its reactivity and functional groups make it suitable for various synthetic routes and reactions.
Used in Antibacterial Applications:
4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) is used as an antibacterial agent due to its ability to inhibit the growth of various bacterial strains. Its broad-spectrum activity makes it a promising candidate for the development of new antibiotics to combat drug-resistant bacteria.
Used in Antifungal Applications:
In the treatment of fungal infections, 4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) is used as an antifungal agent. Its ability to target and inhibit fungal growth has potential applications in the development of antifungal medications and treatments.
Used in Anticancer Applications:
4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) is used as an anticancer agent for its potential role in the treatment of various types of cancer. Its biological activities and ability to target cancer cells make it a valuable compound in the search for novel cancer therapies.
Used in Drug Development:
In the pharmaceutical industry, 4-Thiazolecarboxylic acid, 5-amino-2,3-dihydro-2-thioxo-, ethyl ester (9CI) is used as a starting material for the development of diverse pharmaceutical formulations. Its versatile chemical properties and potential therapeutic applications contribute to the advancement of new drug candidates and treatments for various diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 52868-64-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,2,8,6 and 8 respectively; the second part has 2 digits, 6 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 52868-64:
(7*5)+(6*2)+(5*8)+(4*6)+(3*8)+(2*6)+(1*4)=151
151 % 10 = 1
So 52868-64-1 is a valid CAS Registry Number.
InChI:InChI=1/C6H8N2O2S2/c1-2-10-5(9)3-4(7)12-6(11)8-3/h2,7H2,1H3,(H,8,11)
52868-64-1Relevant academic research and scientific papers
A one-pot synthesis of alkyl 5-amino-2-mercaptothiazole-4-carboxylates and sulphur-Claisen type rearrangement reactions of the corresponding S-allyl/propargyl compounds
Ray, Sibdas,Ghosh, Sukla
, p. 1037 - 1043 (2007/10/03)
Alkyl 5-amino-2-mercaptothiazole-4-carboxylates (5) have been prepared in a one-pot synthesis by the action of hydrogen sulfide on a mixture of alkyl 2-oximino-2-cyanoacetate and trialkyl orthoformate in pyridine; reduction of the oximino group to imino f