5292-42-2 Usage
Uses
Used in Scientific Research:
2,3,4,5-Tetrafluoro-benzoic acid methyl ester is used as a research compound for its unique properties and reactivity. It is particularly valuable in the field of organic synthesis, where it can be employed as an intermediate to produce a variety of complex molecules. 2,3,4,5-TETRAFLUORO-BENZOIC ACID METHYL ESTER's fluorine atoms and methyl ester group contribute to its unique chemical behavior, making it a valuable tool for researchers in the development of new chemical processes and compounds.
Used in Organic Synthesis:
In the field of organic synthesis, 2,3,4,5-tetrafluoro-benzoic acid methyl ester is used as a key intermediate. Its presence in the synthesis process allows for the creation of a wide range of complex molecules with potential applications in various industries, such as pharmaceuticals, materials science, and agrochemicals. 2,3,4,5-TETRAFLUORO-BENZOIC ACID METHYL ESTER's reactivity and the presence of fluorine atoms make it a versatile building block for the development of new molecules with desired properties.
Used in Laboratory Settings:
2,3,4,5-Tetrafluoro-benzoic acid methyl ester is used in laboratory settings for the determination of its physical and chemical properties, such as boiling point, melting point, and density. These properties are essential for understanding the compound's behavior and potential applications. Additionally, the compound's reactivity and potential environmental risks make it a subject of interest for researchers studying the effects of organofluorine compounds on the environment and human health.
Check Digit Verification of cas no
The CAS Registry Mumber 5292-42-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,2,9 and 2 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 5292-42:
(6*5)+(5*2)+(4*9)+(3*2)+(2*4)+(1*2)=92
92 % 10 = 2
So 5292-42-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H4F4O2/c1-14-8(13)3-2-4(9)6(11)7(12)5(3)10/h2H,1H3
5292-42-2Relevant academic research and scientific papers
Processes for producing tetrafluorophthalic anhydride and fluorobenzoic acids
-
, (2008/06/13)
A process for producing tetrafluorophthalic anhydride, which comprises chlorinating tetrachlorophthalic anhydride to obtain 3,3,4,5,6,7-hexachloro-1-[3H]-isobenzofuranone, then fluorinating it to obtain 3,4,5,6-tetrafluorophthaloyldifluoride and/or 3,3,4,5,6,7-hexafluoro-1-[3H]-isobenzofuranone, and further reacting the tetrafluorophthalolyldifluoride and/or the hexafluoro-1-[3H]-isobenzofuranone with an inorganic base or an organic acid to obtain tetrafluorophthalic anhydride.