5329-55-5 Usage
Molecular structure
A complex structure consisting of a six-membered ring with three hydroxyl groups, a phenoxy group, and a dihydroxyethyl group.
Derivative of oxane
It is derived from oxane, a six-membered oxygen-containing heterocyclic compound.
Potential applications
It may have potential applications in the field of medicinal chemistry due to its structural features.
Building block for bioactive molecules
The compound could be useful as a building block for the synthesis of bioactive molecules.
Potential drug candidate
Its structural features may make it a potential drug candidate.
Need for further research
Further research is needed to fully understand its properties and potential uses.
Check Digit Verification of cas no
The CAS Registry Mumber 5329-55-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,3,2 and 9 respectively; the second part has 2 digits, 5 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 5329-55:
(6*5)+(5*3)+(4*2)+(3*9)+(2*5)+(1*5)=95
95 % 10 = 5
So 5329-55-5 is a valid CAS Registry Number.
InChI:InChI=1/C13H18O7/c14-6-8(15)12-10(17)9(16)11(18)13(20-12)19-7-4-2-1-3-5-7/h1-5,8-18H,6H2
