53428-03-8 Usage
Uses
Used in Pharmaceutical Industry:
5-Ethyl-2-pyridine alcohol is used as a reagent for the preparation of benzisoxazole sulfonamides. These compounds are known for their potential therapeutic applications in the treatment of various diseases. The synthesis of benzisoxazole sulfonamides involves the use of 5-Ethyl-2-pyridine alcohol as a key intermediate, which contributes to the development of new drugs with improved efficacy and safety profiles.
Used in Chemical Synthesis:
In the field of organic chemistry, 5-Ethyl-2-pyridine alcohol can be employed as a building block for the synthesis of more complex molecules. Its unique structure allows for various chemical reactions, such as substitution, addition, and condensation, which can lead to the formation of a wide range of compounds with different properties and applications. These synthesized compounds can be used in various industries, including pharmaceuticals, agrochemicals, and materials science.
Used in Research and Development:
5-Ethyl-2-pyridine alcohol is also utilized in research and development laboratories for the study of its chemical properties and potential applications. Researchers can use 5-Ethyl-2-pyridine alcohol to explore new reaction pathways, develop novel synthetic methods, and investigate its biological activities. This knowledge can be applied to the design and development of new drugs, materials, and other products with improved performance and functionality.
Check Digit Verification of cas no
The CAS Registry Mumber 53428-03-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,4,2 and 8 respectively; the second part has 2 digits, 0 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 53428-03:
(7*5)+(6*3)+(5*4)+(4*2)+(3*8)+(2*0)+(1*3)=108
108 % 10 = 8
So 53428-03-8 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO/c1-2-6-3-4-7(9)8-5-6/h3-5H,2H2,1H3,(H,8,9)
53428-03-8Relevant academic research and scientific papers
METHOD OF MAKING A PYRIDONE COMPOUND, 5-ETHYL-1-PHENYL-2-(1H)-PYRIDONE, AND INTERMEDIATES THEREOF
-
Page/Page column 10-11, (2012/08/28)
There are provided methods for the preparation of 5-ethyl-1-phenyl-2(1H)-pyridone and intermediates thereof. Thus, there is provided a one-pot method from the production of 5-ethyl-2(1H)-pyridone from butyl aldehyde and a compound of the Formula 9. There
