53857-59-3 Usage
Uses
Used in Pharmaceutical Industry:
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE is used as a chemical intermediate for the synthesis of various pharmaceuticals. Its unique structure and properties make it a valuable component in the development of new drugs and medications.
Used in Agrochemical Industry:
In the agrochemical sector, 2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE is utilized as an intermediate in the production of agrochemicals. Its role in this industry is crucial for the development of effective and safe products for agricultural applications.
Used in Specialty Polymers Production:
2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE is used as a building block in the creation of specialty polymers. Its incorporation into polymer structures contributes to the development of materials with specific properties tailored for various applications.
Used in Organic Synthesis:
As a reagent in organic synthesis, 2,5-DIBROMO-1-METHYL-1H-IMIDAZOLE plays a significant role in the formation of complex organic compounds. Its presence in chemical reactions facilitates the synthesis of a wide range of organic molecules for various purposes.
Check Digit Verification of cas no
The CAS Registry Mumber 53857-59-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,3,8,5 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 53857-59:
(7*5)+(6*3)+(5*8)+(4*5)+(3*7)+(2*5)+(1*9)=153
153 % 10 = 3
So 53857-59-3 is a valid CAS Registry Number.
InChI:InChI=1/C4H4Br2N2/c1-8-3(5)2-7-4(8)6/h2H,1H3
53857-59-3Relevant academic research and scientific papers
GLYCOLATE OXIDASE INHIBITORS FOR THE TREATMENT OF DISEASE
-
Paragraph 00601; 00602, (2021/01/22)
Described herein are compounds, methods of making such compounds, pharmaceutical compositions and medicaments containing such compounds, and methods of using such compounds to treat or prevent diseases or disorders associated with a defect in glyoxylate metabolism, for example a disease or disorder associated with the enzyme glycolate oxidase (GO) or alterations in oxalate metabolism. Such diseases or disorders include, for example, disorders of glyoxylate metabolism, including primary hyperoxaluria, that are associated with production of excessive amounts of oxalate.
GLYCOLATE OXIDASE INHIBITORS FOR THE TREATMENT OF DISEASE
-
Paragraph 00643; 00644; 00645, (2019/07/17)
Described herein are compounds, methods of making such compounds, pharmaceutical compositions and medicaments containing such compounds, and methods of using such compounds to treat or prevent diseases or disorders associated with the enzyme glycolate oxidase (GO). Such diseases or disorders include, for example, disorders of glyoxylate metabolism, including primary hyperoxaluria, that are associated with production of excessive amounts of oxalate.
