54118-09-1 Usage
Type of Compound
Insecticide and Acaricide
Mechanism of Action
Inhibits the activity of acetylcholinesterase, an enzyme that breaks down the neurotransmitter acetylcholine
Effect on Insects and Mites
Leads to nerve and muscle overstimulation and eventually death
Toxicity
Highly toxic chemical
Precaution
Should be handled with extreme caution due to health risks to humans and animals
Environmental Impact
Banned in many countries due to its environmental impact and potential harm to non-target species
Check Digit Verification of cas no
The CAS Registry Mumber 54118-09-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,1,1 and 8 respectively; the second part has 2 digits, 0 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 54118-09:
(7*5)+(6*4)+(5*1)+(4*1)+(3*8)+(2*0)+(1*9)=101
101 % 10 = 1
So 54118-09-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H27N3O2S2/c1-4-25-18-12-7-8-13-19(18)31-20(25)15-16-10-9-11-17(14-16)21-22(28)26(5-2)24(30)27(6-3)23(21)29/h7-8,12-15H,4-6,9-11H2,1-3H3/b20-15-