5423-53-0 Usage
Uses
Due to the limited information available on 1,2,4-Benzotriazin-3-amine, 7-chloro-, it is not possible to provide a comprehensive list of its applications. However, based on the general properties of benzotriazines, it can be inferred that 1,2,4-BENZOTRIAZIN-3-AMINE, 7-CHLORO- may have potential applications in various industries, such as pharmaceuticals, materials science, or chemical research. Further investigation and research would be required to determine its specific uses and benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 5423-53-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,2 and 3 respectively; the second part has 2 digits, 5 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5423-53:
(6*5)+(5*4)+(4*2)+(3*3)+(2*5)+(1*3)=80
80 % 10 = 0
So 5423-53-0 is a valid CAS Registry Number.
InChI:InChI=1/C7H5ClN4/c8-4-1-2-5-6(3-4)11-12-7(9)10-5/h1-3H,(H2,9,10,12)