5434-51-5 Usage
Uses
Used in Organic Synthesis:
(6-bromobenzo[1,3]dioxol-5-yl)methyl acetate is used as a synthetic intermediate for the production of various organic compounds. Its unique structure and functional groups allow it to be a key building block in the synthesis of complex organic molecules.
Used in Pharmaceutical Chemistry:
In the pharmaceutical industry, (6-bromobenzo[1,3]dioxol-5-yl)methyl acetate is used as a synthetic intermediate in the production of various pharmaceuticals. Its presence in the synthesis process contributes to the development of new drugs with potential therapeutic applications.
Used in Agrochemicals Production:
(6-bromobenzo[1,3]dioxol-5-yl)methyl acetate is also utilized in the agrochemical industry, where it serves as a synthetic intermediate for the development of agrochemicals. Its role in the synthesis process helps create compounds that can be used in agriculture for pest control and crop protection.
Overall, (6-bromobenzo[1,3]dioxol-5-yl)methyl acetate is a multifaceted chemical compound with applications across different industries, primarily due to its unique structure and chemical properties that make it an essential component in the synthesis of a wide range of products.
Check Digit Verification of cas no
The CAS Registry Mumber 5434-51-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,3 and 4 respectively; the second part has 2 digits, 5 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 5434-51:
(6*5)+(5*4)+(4*3)+(3*4)+(2*5)+(1*1)=85
85 % 10 = 5
So 5434-51-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H9BrO4/c1-6(12)13-4-7-2-9-10(3-8(7)11)15-5-14-9/h2-3H,4-5H2,1H3
