5440-23-3 Usage
Uses
Used in Organic Synthesis:
N-(1-Acetyl-2-Oxopropyl) Acetamide serves as a reagent in organic synthesis, facilitating the creation of various chemical compounds. Its role in this process is crucial for the development of new substances with specific properties and applications.
Used in Pharmaceutical Industry:
In the pharmaceutical sector, N-(1-Acetyl-2-Oxopropyl) Acetamide is utilized as a precursor to the production of certain medications. Its involvement in the synthesis of pharmaceuticals underscores its importance in the development of new drugs and therapies.
Used in Research Applications:
Due to its unique chemical properties, N-(1-Acetyl-2-Oxopropyl) Acetamide also finds use in research settings. It aids scientists in studying chemical reactions and exploring new avenues in chemical and material science, potentially leading to breakthroughs in various industries.
Check Digit Verification of cas no
The CAS Registry Mumber 5440-23-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,4 and 0 respectively; the second part has 2 digits, 2 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5440-23:
(6*5)+(5*4)+(4*4)+(3*0)+(2*2)+(1*3)=73
73 % 10 = 3
So 5440-23-3 is a valid CAS Registry Number.
InChI:InChI=1/C7H11NO3/c1-4(9)7(5(2)10)8-6(3)11/h7H,1-3H3,(H,8,11)
5440-23-3Relevant academic research and scientific papers
4-ACYLAMINOPYRAZOLE DERIVATIVES
-
, (2008/06/13)
A 4-acylaminopyrazole derivative represented by the following general formula: wherein R1 is a hydrogen atom, an optionally substituted C1-C16 alkyl group or the like, ???R2 and R3 are independently a
