54404-06-7 Usage
Uses
Used in Pharmaceutical Research:
3-Oxo-2,3-dihydropyridazine-4-carboxylic acid is used as a key intermediate in the synthesis of various pharmaceutical compounds. Its unique chemical structure allows for the development of new drugs with potential therapeutic applications.
Used in Organic Synthesis:
In the field of organic synthesis, 3-Oxo-2,3-dihydropyridazine-4-carboxylic acid serves as a versatile building block for the creation of complex organic molecules. Its reactivity and functional groups enable the formation of diverse chemical entities with potential applications in various industries.
Used in Medicinal Chemistry:
3-Oxo-2,3-dihydropyridazine-4-carboxylic acid is utilized in medicinal chemistry for the design and optimization of novel bioactive molecules. Its heterocyclic structure and carboxylic acid functionality contribute to the development of compounds with improved pharmacological properties, such as enhanced potency, selectivity, and bioavailability.
Used in Drug Discovery:
In drug discovery, 3-Oxo-2,3-dihydropyridazine-4-carboxylic acid is employed as a starting material for the synthesis of potential drug candidates. Its unique structural features and biological activities make it an attractive scaffold for the development of new therapeutic agents targeting various diseases and conditions.
Used in Chemical Libraries:
3-Oxo-2,3-dihydropyridazine-4-carboxylic acid is incorporated into chemical libraries for high-throughput screening and compound optimization. Its presence in these libraries allows researchers to explore its potential as a lead compound for the treatment of various diseases and to identify novel chemical entities with promising biological activities.
Check Digit Verification of cas no
The CAS Registry Mumber 54404-06-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,4,0 and 4 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54404-06:
(7*5)+(6*4)+(5*4)+(4*0)+(3*4)+(2*0)+(1*6)=97
97 % 10 = 7
So 54404-06-7 is a valid CAS Registry Number.
InChI:InChI=1/C5H4N2O3/c8-4-3(5(9)10)1-2-6-7-4/h1-2H,(H,7,8)(H,9,10)
