5462-93-1 Usage
Uses
Used in Pharmaceutical Research:
(6-nitrobenzo[1,3]dioxol-5-yl)methyl acetate is used as a pharmaceutical intermediate for the development of new drugs and medications. Its unique structure and properties make it a promising candidate for creating novel therapeutic agents.
Used in Organic Synthesis:
In the field of organic synthesis, (6-nitrobenzo[1,3]dioxol-5-yl)methyl acetate is used as a key compound for synthesizing various complex organic molecules. Its versatility in chemical reactions allows for the creation of a wide range of products.
Used in Antimicrobial Applications:
Due to its antimicrobial properties, (6-nitrobenzo[1,3]dioxol-5-yl)methyl acetate is used as an active ingredient in the development of antimicrobial agents. These agents can be employed in various industries, such as healthcare and agriculture, to combat the growth of harmful microorganisms.
Used in Industrial Applications:
The unique chemical structure and properties of (6-nitrobenzo[1,3]dioxol-5-yl)methyl acetate may also find use in various industrial applications. These could include the development of new materials, coatings, or other products that benefit from the compound's specific characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 5462-93-1 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 2 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 5462-93:
(6*5)+(5*4)+(4*6)+(3*2)+(2*9)+(1*3)=101
101 % 10 = 1
So 5462-93-1 is a valid CAS Registry Number.
InChI:InChI=1/C10H9NO6/c1-6(12)15-4-7-2-9-10(17-5-16-9)3-8(7)11(13)14/h2-3H,4-5H2,1H3