5465-56-5 Usage
Uses
1-Naphthaleneamine, 2-Methyl-4-nitrois used in various applications across different industries, primarily in the production of dyes, pigments, pharmaceuticals, and agricultural chemicals.
Used in Dye and Pigment Industry:
1-Naphthaleneamine, 2-Methyl-4-nitrois used as an intermediate in the synthesis of dyes and pigments. Its chemical structure allows for the formation of various colored compounds, making it a valuable component in the production of a wide range of dyes and pigments for various applications.
Used in Pharmaceutical Industry:
1-Naphthaleneamine, 2-Methyl-4-nitrois used as a building block in the synthesis of certain pharmaceuticals. Its unique chemical properties enable the development of drugs with specific therapeutic effects. However, due to its toxic nature, it is essential to ensure that the final pharmaceutical products are safe for human consumption.
Used in Agricultural Chemical Industry:
1-Naphthaleneamine, 2-Methyl-4-nitrois also utilized in the manufacturing of agricultural chemicals, such as herbicides and pesticides. Its chemical properties contribute to the effectiveness of these chemicals in controlling pests and weeds, thereby enhancing crop productivity.
Check Digit Verification of cas no
The CAS Registry Mumber 5465-56-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,4,6 and 5 respectively; the second part has 2 digits, 5 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5465-56:
(6*5)+(5*4)+(4*6)+(3*5)+(2*5)+(1*6)=105
105 % 10 = 5
So 5465-56-5 is a valid CAS Registry Number.
InChI:InChI=1/C11H10N2O2/c1-7-6-10(13(14)15)8-4-2-3-5-9(8)11(7)12/h2-6H,12H2,1H3
