54679-16-2 Usage
Uses
Used in Chemical Synthesis:
4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole is used as a key intermediate in the synthesis of various organic compounds. Its unique structure allows for the formation of new chemical bonds and the creation of a wide range of derivatives, making it a valuable building block in the development of novel molecules.
Used in Pharmaceutical Research:
In the pharmaceutical industry, 4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole is employed as a potential candidate for drug development. Its structural features enable it to interact with biological targets, such as enzymes and receptors, which can lead to the discovery of new therapeutic agents. Researchers are particularly interested in exploring its potential applications in the treatment of various diseases and conditions.
Used in Material Science:
4-(Chloromethyl)-2-(2-thienyl)-1,3-thiazole is also utilized in the field of material science, where it can be incorporated into the design and synthesis of new materials with unique properties. Its presence in these materials can influence their electronic, optical, and mechanical characteristics, opening up possibilities for applications in areas such as electronics, sensors, and energy storage devices.
Check Digit Verification of cas no
The CAS Registry Mumber 54679-16-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,4,6,7 and 9 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 54679-16:
(7*5)+(6*4)+(5*6)+(4*7)+(3*9)+(2*1)+(1*6)=152
152 % 10 = 2
So 54679-16-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H6ClNS2/c9-4-6-5-12-8(10-6)7-2-1-3-11-7/h1-3,5H,4H2
54679-16-2Relevant articles and documents
Heterocyclic compounds, their production and use
-
, (2008/06/13)
Heterocyclic compounds represented by the general formula (I) wherein R stands for an optionally substituted aromatic heterocyclic group; X stands for oxygen atom, an optionally oxidated sulfur atom, —C(═O)— or —CH(OH)—; Y stands for CH or N; m denotes an integer of 0 to 10: n denotes an integer of 1 to 5: cyclic group ?stands for an optionally substituted aromatic azole group; and ring A is optionally further substituted, or salts thereof. The compound (I) possesses action of inhibiting tyrosine kinase and useful as antitumor agents.
