55047-82-0 Usage
General Description
Succinimide, silver(1+) salt is a chemical compound used in various applications including organic synthesis and pharmaceuticals. Succinimide is a cyclic imide, or dicarboximide, and is commonly used as a reagent in organic chemistry for the synthesis of various compounds. The silver(1+) salt of succinimide is formed by reacting succinimide with silver oxide or silver nitrate, and is utilized in various organic reactions as a catalyst or as a source of silver ions. succinimide, silver(1+) salt has been found to have antimicrobial properties, making it suitable for use in the production of antibacterial and antifungal agents. Additionally, silver(1+) salt of succinimide has potential applications in the field of nanotechnology and material science due to its ability to form nanoparticles and nanocomposites.
Check Digit Verification of cas no
The CAS Registry Mumber 55047-82-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,0,4 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 55047-82:
(7*5)+(6*5)+(5*0)+(4*4)+(3*7)+(2*8)+(1*2)=120
120 % 10 = 0
So 55047-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H5NO2.Ag/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7);/q;+1
55047-82-0Relevant articles and documents
Synthesis and characterization of organophosphine/phosphite stabilized N-silver(I) succinimide: crystal structure of [(Ph3P)3 · AgNC4H4O2]
Tao, Xian,Li, Yue-Qin,Xu, Hui-Hua,Wang, Ning,Du, Fang-Li,Shen, Ying-Zhong
, p. 1191 - 1195 (2009/09/08)
Six organophosphine/phosphite stabilized N-silver(I) succinimide complexes of the type Ln · AgNC4H4O2 (L = PPh3; n = 1, 2a; n = 2, 2b; n = 3, 2c; L = P(OEt)3; n = 1, 2d; n = 2, 2e; n = 3, 2
