55047-82-0 Usage
Uses
Used in Organic Synthesis:
Succinimide, silver(1+) salt is used as a catalyst in various organic reactions for its ability to facilitate the synthesis of different compounds.
Used in Pharmaceutical Industry:
Succinimide, silver(1+) salt is used as an antimicrobial agent for its effectiveness in inhibiting the growth of bacteria and fungi, making it suitable for the production of antibacterial and antifungal agents.
Used in Nanotechnology and Material Science:
Succinimide, silver(1+) salt is used as a precursor for the formation of nanoparticles and nanocomposites, which can be utilized in various applications due to their unique properties.
Check Digit Verification of cas no
The CAS Registry Mumber 55047-82-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,0,4 and 7 respectively; the second part has 2 digits, 8 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 55047-82:
(7*5)+(6*5)+(5*0)+(4*4)+(3*7)+(2*8)+(1*2)=120
120 % 10 = 0
So 55047-82-0 is a valid CAS Registry Number.
InChI:InChI=1/C4H5NO2.Ag/c6-3-1-2-4(7)5-3;/h1-2H2,(H,5,6,7);/q;+1
55047-82-0Relevant academic research and scientific papers
Synthesis and characterization of organophosphine/phosphite stabilized N-silver(I) succinimide: crystal structure of [(Ph3P)3 · AgNC4H4O2]
Tao, Xian,Li, Yue-Qin,Xu, Hui-Hua,Wang, Ning,Du, Fang-Li,Shen, Ying-Zhong
, p. 1191 - 1195 (2009/09/08)
Six organophosphine/phosphite stabilized N-silver(I) succinimide complexes of the type Ln · AgNC4H4O2 (L = PPh3; n = 1, 2a; n = 2, 2b; n = 3, 2c; L = P(OEt)3; n = 1, 2d; n = 2, 2e; n = 3, 2
