5506-97-8 Usage
Uses
Used in Organic Synthesis:
5-Pyrimidinecarbonitrile, 2-methyl(7CI,8CI,9CI) is utilized as a key intermediate in organic synthesis for the preparation of various pyrimidine-based compounds. Its unique structure allows for the formation of diverse chemical entities through reactions such as nucleophilic addition, electrophilic substitution, and cycloaddition.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, 5-Pyrimidinecarbonitrile, 2-methyl(7CI,8CI,9CI) serves as a building block for the development of pharmaceutical agents. Its reactivity and structural features enable the synthesis of bioactive molecules with potential therapeutic applications, including antiviral, anticancer, and antimicrobial agents.
Used in Material Science:
5-Pyrimidinecarbonitrile, 2-methyl(7CI,8CI,9CI) is employed in material science for the design and synthesis of novel materials with specific properties. Its incorporation into polymers, dendrimers, or other supramolecular structures can lead to materials with tailored characteristics, such as improved conductivity, enhanced stability, or specific binding affinities.
Check Digit Verification of cas no
The CAS Registry Mumber 5506-97-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,0 and 6 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 5506-97:
(6*5)+(5*5)+(4*0)+(3*6)+(2*9)+(1*7)=98
98 % 10 = 8
So 5506-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H5N3/c1-5-8-3-6(2-7)4-9-5/h3-4H,1H3
5506-97-8Relevant academic research and scientific papers
SULFUR-CONTAINING HETEROCYCLIC DERIVATIVE HAVING ?-SECRETASE-INHIBITING ACTIVITY
-
Page/Page column 78-79, (2011/04/25)
The following compound is provided as an agent for treating a disease induced by production, secretion and/or deposition of amyloid β protein, for example,. a compound represented by the formula (I): wherein ruing A is an optionally substituted carbocyclic group or an optionally substituted heterocyclic group, R1 is optionally substituted lower alkyl or the like, R2a and R2b are each independently hydrogen, optionally substituted lower alkyl or the like, R3a and R3c are each independently hydrogen, halogen, hydroxy, optionally substituted lower alkyl or the like, or a pharmaceutically acceptable salt thereof, or a solvate thereof.
