5518-76-3 Usage
Uses
Used in Pharmaceutical Industry:
2-Ethylthio-1,4-dihydro-4-oxo-5-pyrimidinecarboxylic acid ethyl ester is used as an intermediate in the synthesis of various drugs for its potential pharmacological properties and therapeutic applications. It plays a crucial role in the development of new drugs and medicines.
Used in Medicinal Research and Development:
2-Ethylthio-1,4-dihydro-4-oxo-5-pyrimidinecarboxylic acid ethyl ester is used as a valuable compound in medicinal research and development for its potential therapeutic applications. It is being researched for its potential to contribute to the discovery and development of new pharmaceuticals.
Check Digit Verification of cas no
The CAS Registry Mumber 5518-76-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,1 and 8 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 5518-76:
(6*5)+(5*5)+(4*1)+(3*8)+(2*7)+(1*6)=103
103 % 10 = 3
So 5518-76-3 is a valid CAS Registry Number.
InChI:InChI=1/C9H12N2O3S/c1-3-14-8(13)6-5-10-9(15-4-2)11-7(6)12/h5H,3-4H2,1-2H3,(H,10,11,12)
