5536-40-3 Usage
Uses
Used in Pharmaceutical Industry:
(4-Hydroxy-2,6-Dimethyl-pyrimidin-5-yl)-acetic acid is used as a chemical intermediate for the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs, particularly those targeting specific biological pathways or receptors.
Used in Chemical Research:
In the field of chemical research, (4-Hydroxy-2,6-Dimethyl-pyrimidin-5-yl)-acetic acid serves as a valuable compound for studying the effects of different functional groups on the properties and reactivity of pyrimidine derivatives. This can lead to a better understanding of the underlying chemistry and potential applications in various industries.
Used in Material Science:
(4-Hydroxy-2,6-Dimethyl-pyrimidin-5-yl)-acetic acid may be utilized in the development of new materials with specific properties, such as improved stability or reactivity. Its incorporation into polymers or other materials could result in novel applications in areas like electronics, coatings, or adhesives.
Used in Agricultural Industry:
As a chemical compound with potential biological activity, (4-Hydroxy-2,6-Dimethyl-pyrimidin-5-yl)-acetic acid could be explored for its possible use in the agricultural industry. It may have applications as a pesticide, herbicide, or growth regulator, depending on its effects on plants and pests. Further research would be required to determine its safety and efficacy in this context.
Check Digit Verification of cas no
The CAS Registry Mumber 5536-40-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,3 and 6 respectively; the second part has 2 digits, 4 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 5536-40:
(6*5)+(5*5)+(4*3)+(3*6)+(2*4)+(1*0)=93
93 % 10 = 3
So 5536-40-3 is a valid CAS Registry Number.
InChI:InChI=1/C8H10N2O3/c1-4-6(3-7(11)12)8(13)10-5(2)9-4/h3H2,1-2H3,(H,11,12)(H,9,10,13)
5536-40-3Relevant academic research and scientific papers
Dimethyl acetylsuccinate as a versatile synthon in heterocyclic chemistry - A facile synthesis of heterocyclic acetic acid derivatives
Craig, G. Wayne,Eberle, Martin,Lamberth, Clemens,Vettiger, Thomas
, p. 504 - 507 (2007/10/03)
The preparation of novel acetic acid derivatives of pyrazole 3a,b and pyrimidine 2a-e is achieved by condensation of dimethyl acetylsuccinate (1) with appropriate reaction partners. Also triethyl 1,1,2-ethanetricarboxylate (6) is a valuable starting material, which is demonstrated by the synthesis of previously unknown pyrimidin-5-yl acetates. Wiley-VCH Verlag GmbH, 2000.
Pyrimidinyl acrylic acid derivatives
-
, (2008/06/13)
The invention discloses compounds of formula I It has now been found that compounds of formula I STR1 wherein R1 is hydrogen, methyl, ethyl or trifluoromethyl, and R2 is hydrogen, methyl, ethyl, C1-4 alkylthio, C1-4/
