55366-16-0 Usage
Uses
Used in Pharmaceutical Industry:
[1,2,4]Triazolo[1,5-a]pyrazin-8(7H)-one,hydrazone(9CI) is used as a key intermediate in the synthesis of pharmaceutical compounds for its potential biological activities. The hydrazone group allows for the development of derivatives with specific therapeutic properties, making it a valuable component in drug discovery and design.
Used in Agrochemical Industry:
In the agrochemical industry, [1,2,4]Triazolo[1,5-a]pyrazin-8(7H)-one,hydrazone(9CI) is utilized as a building block for the creation of agrochemicals with potential pesticidal or herbicidal properties. The unique structure and hydrazone functionality of the compound contribute to the development of novel and effective agrochemicals.
Used in Materials Science:
[1,2,4]Triazolo[1,5-a]pyrazin-8(7H)-one,hydrazone(9CI) is employed in materials science for the development of new materials with specific properties. [1,2,4]Triazolo[1,5-a]pyrazin-8(7H)-one,hydrazone(9CI)'s unique structure and hydrazone group can be utilized to create materials with tailored characteristics, such as improved stability, reactivity, or selectivity, for various applications.
Overall, [1,2,4]Triazolo[1,5-a]pyrazin-8(7H)-one, hydrazone(9CI) is a compound of interest for further research and development due to its unique structure and potential applications across different industries. Its versatility in synthesis and potential for creating derivatives with specific properties make it a promising candidate for exploration in various fields.
Check Digit Verification of cas no
The CAS Registry Mumber 55366-16-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,3,6 and 6 respectively; the second part has 2 digits, 1 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55366-16:
(7*5)+(6*5)+(5*3)+(4*6)+(3*6)+(2*1)+(1*6)=130
130 % 10 = 0
So 55366-16-0 is a valid CAS Registry Number.
InChI:InChI=1/C5H6N6/c6-10-4-5-8-3-9-11(5)2-1-7-4/h1-3H,6H2,(H,7,10)
55366-16-0Relevant academic research and scientific papers
Ring Opening or Rearrangement versus N-Oxidation in the Action of Peracids upon Pyrrolopyridines, Pyrrolopyrazines, and Triazolo- and Triazolo-pyrazine. Some Chemical and Spectroscopic Properties of the Triazolopyrazines and Th
Hardy, Christopher R.,Parrick, John
, p. 506 - 511 (2007/10/02)
Peracid oxidation of the title heterocycles has shown a variety of reaction pathways. 1-Methyl-2,3-diphenyl-1H-pyrrolopyridine (8) gave a ring-opening product (13), while 3-methyl-2-phenyl-1H-pyrrolopyrazine gave N-benzoylurea.In contrast, t
