553672-05-2 Usage
General Description
5-Amino-3-cyclohexyl-1-methyl-1H-pyrazole-4-carbonitrile is a chemical compound with the molecular formula C11H15N5. It is a pyrazole derivative with a cyclohexyl and a methyl group attached to the nitrogen atom. 5-Amino-3-cyclohexyl-1-methyl-1H-pyrazole-4-carbonitrile is commonly used in medicinal chemistry as a building block for the synthesis of various biologically active molecules. It has been researched for its potential pharmacological properties, including as an analgesic, anti-inflammatory, and antitumor agent. Its unique structure and properties make it a valuable tool for the development of new drugs and chemical compounds with potential therapeutic applications.
Check Digit Verification of cas no
The CAS Registry Mumber 553672-05-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 5,5,3,6,7 and 2 respectively; the second part has 2 digits, 0 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 553672-05:
(8*5)+(7*5)+(6*3)+(5*6)+(4*7)+(3*2)+(2*0)+(1*5)=162
162 % 10 = 2
So 553672-05-2 is a valid CAS Registry Number.
InChI:InChI=1/C11H16N4/c1-15-11(13)9(7-12)10(14-15)8-5-3-2-4-6-8/h8H,2-6,13H2,1H3
553672-05-2Relevant articles and documents
PYRAZOLOPYRIMIDINONE DERIVATIVES HAVING PDE7?INHIBITORY ACTIVITY
-
Page 24, (2010/02/08)
Pyrazolopyrimidinone derivatives expressed by the following general formula (IA) or (IB): and the following general formula (IA') or (IB'): where the symbols are as disclosed in the specification, are provided as desired compounds. These compounds have the action of selectively inhibiting PDE7, thereby increasing the intracellular cAMP level and inhibiting the activation of T cells. Thus, they are useful for prevention and treatment of various allergic diseases and inflammatory or immunological diseases.
