55405-65-7 Usage
Uses
Used in Pharmaceutical Research and Development:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE is used as a potential candidate for the development of new drugs due to its unique structure and properties. It may contribute to the creation of innovative therapeutic agents that address various medical conditions.
Used in Chemical Research:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE serves as a building block for the synthesis of other organic compounds. Its presence in chemical reactions can lead to the formation of new molecules with diverse applications in various industries.
Used in Drug Synthesis:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE is used as a key intermediate in the synthesis of pharmaceutical compounds. Its unique structure allows for the development of novel drug molecules with improved efficacy and selectivity.
Used in Medicinal Chemistry:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE is utilized as a structural component in the design of new medicinal agents. Its incorporation into drug molecules can enhance their pharmacological properties, such as potency, selectivity, and bioavailability.
Used in Chemical Synthesis:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE is employed as a reagent or catalyst in various chemical synthesis processes. Its unique properties can facilitate the formation of desired products with high yields and selectivity.
Used in Material Science:
6-NITROPYRAZOLO[1,5-A]PYRIMIDINE may find applications in the development of new materials with specific properties, such as high thermal stability, electrical conductivity, or optical characteristics. Its unique structure can contribute to the creation of advanced materials for various applications, including electronics, energy storage, and sensing devices.
Check Digit Verification of cas no
The CAS Registry Mumber 55405-65-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,0 and 5 respectively; the second part has 2 digits, 6 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 55405-65:
(7*5)+(6*5)+(5*4)+(4*0)+(3*5)+(2*6)+(1*5)=117
117 % 10 = 7
So 55405-65-7 is a valid CAS Registry Number.
InChI:InChI=1/C6H4N4O2/c11-10(12)5-3-7-6-1-2-8-9(6)4-5/h1-4H
