55405-68-0 Usage
Uses
Used in Pharmaceutical Industry:
3,6-Dibromopyrazolo[1,5-a]pyrimidine is used as a potential drug candidate for the development of new medications. Its unique structure and chemical properties make it a promising starting point for the design and synthesis of novel therapeutic agents.
Used in Organic Synthesis:
3,6-Dibromopyrazolo[1,5-a]pyrimidine serves as a valuable building block in organic synthesis. Its versatile structure allows for the creation of a wide range of chemical compounds, expanding the scope of chemical research and development.
Used in Chemical Research:
3,6-Dibromopyrazolo[1,5-a]pyrimidine is utilized in chemical research to study its biological activity and explore its potential as an inhibitor of certain enzymes and receptors. This research contributes to the understanding of its mechanism of action and its potential applications in various scientific fields.
Check Digit Verification of cas no
The CAS Registry Mumber 55405-68-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,4,0 and 5 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 55405-68:
(7*5)+(6*5)+(5*4)+(4*0)+(3*5)+(2*6)+(1*8)=120
120 % 10 = 0
So 55405-68-0 is a valid CAS Registry Number.
InChI:InChI=1/C6H3Br2N3/c7-4-1-9-6-5(8)2-10-11(6)3-4/h1-3H
