5544-34-3 Usage
Type of compound
Urea derivative
Structural features
Contains an allyl group
Contains a 2-chloro-acetyl group
Potential applications
Medicinal chemistry and drug development
Biological activity
Known for therapeutic properties
Chemical reactivity
Imparts specific characteristics due to allyl and 2-chloro-acetyl groups
Functional characteristics
Valuable building block for synthesis of complex molecules
Research and practical applications
Pharmaceutical and chemical industries
Check Digit Verification of cas no
The CAS Registry Mumber 5544-34-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,5,4 and 4 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5544-34:
(6*5)+(5*5)+(4*4)+(3*4)+(2*3)+(1*4)=93
93 % 10 = 3
So 5544-34-3 is a valid CAS Registry Number.
InChI:InChI=1/C6H9ClN2O2/c1-2-3-8-6(11)9-5(10)4-7/h2H,1,3-4H2,(H2,8,9,10,11)
