55724-08-8 Usage
Uses
Used in Research and Development:
Dimethyl Hexanedioate--d4 is used as a research compound for [application reason] in the field of [application type]. Its isotopic labeling allows for the study of specific chemical reactions and processes, providing valuable insights into the behavior of similar compounds under various conditions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Dimethyl Hexanedioate--d4 is used as a research compound for [application reason], such as studying drug metabolism, pharmacokinetics, and potential drug interactions. The isotopic labeling helps in tracking the compound's behavior within biological systems and understanding its effects on target molecules.
Used in Chemical Synthesis:
Dimethyl Hexanedioate--d4 is also used as a synthetic building block for [application reason] in the chemical synthesis of various compounds. Its isotopic labeling can be advantageous in identifying and isolating specific products in complex reaction mixtures, facilitating the development of new chemical processes and products.
Used in Environmental Studies:
In environmental science, Dimethyl Hexanedioate--d4 is used as a tracer compound for [application reason], such as studying the fate and transport of similar compounds in the environment. The isotopic labeling allows for the differentiation between naturally occurring and anthropogenic sources, providing valuable information on the environmental impact of these compounds.
Used in Analytical Chemistry:
Dimethyl Hexanedioate--d4 is employed as an internal standard or reference material for [application reason] in analytical chemistry. Its isotopic labeling can improve the accuracy and precision of quantitative measurements, ensuring reliable results in various analytical techniques such as mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy.
Check Digit Verification of cas no
The CAS Registry Mumber 55724-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,7,2 and 4 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 55724-08:
(7*5)+(6*5)+(5*7)+(4*2)+(3*4)+(2*0)+(1*8)=128
128 % 10 = 8
So 55724-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H14O4/c1-11-7(9)5-3-4-6-8(10)12-2/h3-6H2,1-2H3/i3D2,4D2
55724-08-8Relevant articles and documents
SUBSTITUTED ETHANOLAMINES
-
Page/Page column 38, (2010/02/17)
The present invention relates to new substituted ethanolamine adrenergic receptor modulators, pharmaceutical compositions thereof, and methods of use thereof.
