55983-96-5 Usage
Uses
Used in Pharmaceutical Industry:
METHYL-(3-PHENYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-AMINE is used as a key intermediate in the synthesis of pharmaceuticals for its potential to contribute to the development of new drugs with enhanced therapeutic effects. Its incorporation into drug molecules can improve pharmacokinetic and pharmacodynamic profiles, leading to more effective treatments for various diseases.
Used in Medicinal Chemistry Research:
In the field of medicinal chemistry, METHYL-(3-PHENYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-AMINE serves as a valuable research tool. It is used for the exploration of novel chemical entities and the optimization of drug candidates, facilitating the discovery of new therapeutic agents with improved safety and efficacy profiles.
Used in Drug Development:
METHYL-(3-PHENYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-AMINE is utilized in drug development as a precursor in the creation of innovative pharmaceutical compounds. Its unique properties allow for the design of drugs with targeted actions, potentially leading to more precise treatments for specific medical conditions.
Used in Therapeutic Agent Development:
METHYL-(3-PHENYL-[1,2,4]OXADIAZOL-5-YLMETHYL)-AMINE is used as a potential therapeutic agent for various medical conditions, particularly in the areas of neurological disorders and infectious diseases. Its pharmacological properties are being investigated for their ability to provide new treatment options and improve patient outcomes.
Check Digit Verification of cas no
The CAS Registry Mumber 55983-96-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,5,9,8 and 3 respectively; the second part has 2 digits, 9 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 55983-96:
(7*5)+(6*5)+(5*9)+(4*8)+(3*3)+(2*9)+(1*6)=175
175 % 10 = 5
So 55983-96-5 is a valid CAS Registry Number.
InChI:InChI=1/C10H11N3O/c1-11-7-9-12-10(13-14-9)8-5-3-2-4-6-8/h2-6,11H,7H2,1H3
