56181-63-6 Usage
General Description
[1-(biphenyl-4-yl)-2-phenylethyl]malonic acid is a chemical compound with the molecular formula C22H18O4. It is a malonic acid derivative with a biphenyl-4-yl and phenylethyl group attached to the malonic acid moiety. It is mainly used in organic synthesis and pharmaceutical research as a building block for creating various organic compounds and drug molecules. [1-(biphenyl-4-yl)-2-phenylethyl]malonic acid has potential applications in medicinal chemistry and drug discovery due to its versatile chemical structure and potential pharmacological properties. The compound may also have potential uses in material science and other industrial applications.
Check Digit Verification of cas no
The CAS Registry Mumber 56181-63-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,1,8 and 1 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 56181-63:
(7*5)+(6*6)+(5*1)+(4*8)+(3*1)+(2*6)+(1*3)=126
126 % 10 = 6
So 56181-63-6 is a valid CAS Registry Number.
InChI:InChI=1/C23H20O4/c24-22(25)21(23(26)27)20(15-16-7-3-1-4-8-16)19-13-11-18(12-14-19)17-9-5-2-6-10-17/h1-14,20-21H,15H2,(H,24,25)(H,26,27)