5622-34-4 Usage
Uses
Used in Pharmaceutical Research:
6-Quinolineacetic acid is used as a research compound for the development of new drugs, particularly for its anti-malarial and anti-bacterial properties. It serves as a valuable starting material in the synthesis of various pharmaceutical agents, contributing to the advancement of treatments for infectious diseases.
Used in Chemical Synthesis:
In the field of organic chemistry, 6-Quinolineacetic acid is used as a starting material for the synthesis of other complex chemical compounds. Its versatile structure allows for the creation of a wide range of derivatives, making it an essential component in the development of new chemical entities for various applications.
Used in Research and Development:
6-Quinolineacetic acid is employed as a research tool in various scientific studies, including the investigation of its potential applications in medicine and other fields. Its unique properties and reactivity make it a valuable asset in the exploration of new chemical pathways and the discovery of novel compounds with potential therapeutic or industrial uses.
Check Digit Verification of cas no
The CAS Registry Mumber 5622-34-4 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 5,6,2 and 2 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 5622-34:
(6*5)+(5*6)+(4*2)+(3*2)+(2*3)+(1*4)=84
84 % 10 = 4
So 5622-34-4 is a valid CAS Registry Number.
InChI:InChI=1/C11H9NO2/c13-11(14)7-8-3-4-10-9(6-8)2-1-5-12-10/h1-6H,7H2,(H,13,14)
