56416-12-7 Usage
Description
[(4-nitrophenyl)methyl]succinic acid, also known as D,L-(p-nitrobenzyl)succinic acid, is an organic compound with the molecular formula C10H9NO6. It is an off-white solid and serves as a crucial intermediate in the synthesis of various compounds, particularly in the field of biochemistry and pharmaceuticals.
Uses
Used in Biochemical Applications:
[(4-nitrophenyl)methyl]succinic acid is used as an intermediate in the synthesis of D,L-(p-aminobenzyl)succinic acid, which is a ligand for affinity chromatographic isolation of pancreatic carboxypeptidase A and B enzymes. This application is significant in the study and purification of these enzymes, which play essential roles in the digestive process and other biological functions.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, [(4-nitrophenyl)methyl]succinic acid is utilized as a key component in the development of drugs targeting specific enzymes. Its role as an intermediate allows for the creation of compounds with potential therapeutic applications, contributing to the advancement of medicine and healthcare.
Used in Chemical Synthesis:
[(4-nitrophenyl)methyl]succinic acid is also employed in chemical synthesis for the production of various compounds with different applications across multiple industries. Its versatility as a synthetic intermediate makes it a valuable asset in the development of new materials and products.
Check Digit Verification of cas no
The CAS Registry Mumber 56416-12-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,4,1 and 6 respectively; the second part has 2 digits, 1 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 56416-12:
(7*5)+(6*6)+(5*4)+(4*1)+(3*6)+(2*1)+(1*2)=117
117 % 10 = 7
So 56416-12-7 is a valid CAS Registry Number.
InChI:InChI=1/C11H11NO6/c13-10(14)6-8(11(15)16)5-7-1-3-9(4-2-7)12(17)18/h1-4,8H,5-6H2,(H,13,14)(H,15,16)