56523-59-2 Usage
Uses
Used in Chemical Production:
15-Bromopentadecanoic acid is used as a raw material for the production of various chemical products, such as surfactants and pharmaceuticals, due to its unique chemical structure and properties.
Used in Organic Synthesis:
In the field of organic synthesis, 15-Bromopentadecanoic acid is used as a building block for the creation of new compounds with diverse properties, contributing to the development of novel materials and substances.
Used in Pharmaceutical Industry:
15-Bromopentadecanoic acid is used as an intermediate in the synthesis of pharmaceuticals, potentially contributing to the development of new drugs and therapeutic agents.
Used in Surfactant Industry:
As a component in the production of surfactants, 15-Bromopentadecanoic acid is used to enhance the properties of these compounds, such as solubility, emulsification, and foaming, which are essential in various applications across different industries.
Check Digit Verification of cas no
The CAS Registry Mumber 56523-59-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,6,5,2 and 3 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 56523-59:
(7*5)+(6*6)+(5*5)+(4*2)+(3*3)+(2*5)+(1*9)=132
132 % 10 = 2
So 56523-59-2 is a valid CAS Registry Number.
InChI:InChI=1/C15H29BrO2/c16-14-12-10-8-6-4-2-1-3-5-7-9-11-13-15(17)18/h1-14H2,(H,17,18)
